C9H15NO4 — CID 155658790
N-[2-hydroxyethoxy(oxiran-2-yl)methyl]-2-methylprop-2-enamide (PubChem CID 155658790) has the molecular formula C9H15NO4 and a molecular weight of 201.22 g/mol. Its IUPAC name is N-[2-hydroxyethoxy(oxiran-2-yl)methyl]-2-methylprop-2-enamide.
| Compound Name | N-[2-hydroxyethoxy(oxiran-2-yl)methyl]-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 155658790 |
| Molecular Formula | C9H15NO4 |
| Molecular Weight | 201.22 g/mol |
| Exact Mass | 201.10 |
| IUPAC Name | N-[2-hydroxyethoxy(oxiran-2-yl)methyl]-2-methylprop-2-enamide |
| SMILES | C=C(C)C(=O)NC(OCCO)C1CO1 |
| InChI | InChI=1S/C9H15NO4/c1-6(2)8(12)10-9(7-5-14-7)13-4-3-11/h7,9,11H,1,3-5H2,2H3,(H,10,12) |
| InChIKey | XVYLANDOBDCSTH-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.22 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|