C12H18S — CID 155719800
4-ethyl-3,5-dimethylideneocta-1,6-diene-4-thiol (PubChem CID 155719800) has the molecular formula C12H18S and a molecular weight of 194.34 g/mol. Its IUPAC name is 4-ethyl-3,5-dimethylideneocta-1,6-diene-4-thiol.
| Compound Name | 4-ethyl-3,5-dimethylideneocta-1,6-diene-4-thiol |
|---|---|
| PubChem CID | 155719800 |
| Molecular Formula | C12H18S |
| Molecular Weight | 194.34 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | 4-ethyl-3,5-dimethylideneocta-1,6-diene-4-thiol |
| SMILES | C=CC(=C)C(S)(CC)C(=C)C=CC |
| InChI | InChI=1S/C12H18S/c1-6-9-11(5)12(13,8-3)10(4)7-2/h6-7,9,13H,2,4-5,8H2,1,3H3 |
| InChIKey | VJWFKIOIQVZTGC-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.34 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|