C21H20N2O3 — CID 155804063
3-(3,4-dimethoxyphenyl)-8-methoxy-5-methylpyrido[4,3-b]indole (PubChem CID 155804063) has the molecular formula C21H20N2O3 and a molecular weight of 348.40 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-8-methoxy-5-methylpyrido[4,3-b]indole.
| Compound Name | 3-(3,4-dimethoxyphenyl)-8-methoxy-5-methylpyrido[4,3-b]indole |
|---|---|
| PubChem CID | 155804063 |
| Molecular Formula | C21H20N2O3 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-8-methoxy-5-methylpyrido[4,3-b]indole |
| SMILES | COc1ccc2c(c1)c1cnc(-c3ccc(OC)c(OC)c3)cc1n2C |
| InChI | InChI=1S/C21H20N2O3/c1-23-18-7-6-14(24-2)10-15(18)16-12-22-17(11-19(16)23)13-5-8-20(25-3)21(9-13)26-4/h5-12H,1-4H3 |
| InChIKey | HOUJZLGSQAPOTG-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 45.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |