C21H26N8O — CID 155814812
N-(3-butyl-2-methylbenzimidazol-5-yl)-2-morpholin-4-yl-7H-purin-6-amine (PubChem CID 155814812) has the molecular formula C21H26N8O and a molecular weight of 406.49 g/mol. Its IUPAC name is N-(3-butyl-2-methylbenzimidazol-5-yl)-2-morpholin-4-yl-7H-purin-6-amine.
| Compound Name | N-(3-butyl-2-methylbenzimidazol-5-yl)-2-morpholin-4-yl-7H-purin-6-amine |
|---|---|
| PubChem CID | 155814812 |
| Molecular Formula | C21H26N8O |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.22 |
| IUPAC Name | N-(3-butyl-2-methylbenzimidazol-5-yl)-2-morpholin-4-yl-7H-purin-6-amine |
| SMILES | CCCCn1c(C)nc2ccc(Nc3nc(N4CCOCC4)nc4nc[nH]c34)cc21 |
| InChI | InChI=1S/C21H26N8O/c1-3-4-7-29-14(2)24-16-6-5-15(12-17(16)29)25-20-18-19(23-13-22-18)26-21(27-20)28-8-10-30-11-9-28/h5-6,12-13H,3-4,7-11H2,1-2H3,(H2,22,23,25,26,27) |
| InChIKey | DZTFSSSSPVPOBS-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 96.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |