C21H16Cl2N2O3S2 — CID 155907401
N-(2,4-dichlorophenyl)-2-[(1R,10R)-15-oxo-8-oxa-12,16-dithia-14-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2,4,6,13(17)-tetraen-14-yl]acetamide (PubChem CID 155907401) has the molecular formula C21H16Cl2N2O3S2 and a molecular weight of 479.41 g/mol. Its IUPAC name is N-(2,4-dichlorophenyl)-2-[(1R,10R)-15-oxo-8-oxa-12,16-dithia-14-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2,4,6,13(17)-tetraen-14-yl]acetamide.
| Compound Name | N-(2,4-dichlorophenyl)-2-[(1R,10R)-15-oxo-8-oxa-12,16-dithia-14-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2,4,6,13(17)-tetraen-14-yl]acetamide |
|---|---|
| PubChem CID | 155907401 |
| Molecular Formula | C21H16Cl2N2O3S2 |
| Molecular Weight | 479.41 g/mol |
| Exact Mass | 478.00 |
| IUPAC Name | N-(2,4-dichlorophenyl)-2-[(1R,10R)-15-oxo-8-oxa-12,16-dithia-14-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2,4,6,13(17)-tetraen-14-yl]acetamide |
| SMILES | O=C(Cn1c2c(sc1=O)[C@H]1c3ccccc3OC[C@@H]1CS2)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C21H16Cl2N2O3S2/c22-12-5-6-15(14(23)7-12)24-17(26)8-25-20-19(30-21(25)27)18-11(10-29-20)9-28-16-4-2-1-3-13(16)18/h1-7,11,18H,8-10H2,(H,24,26)/t11-,18-/m1/s1 |
| InChIKey | UHFGHRJHEDQBHN-ADLMAVQZSA-N |
| XLogP | 5.10 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.41 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'} |
|---|