C22H20N2O3S2 — CID 2045040
N-(2-methylphenyl)-2-[(1R,10S)-15-oxo-8-oxa-12,16-dithia-14-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2,4,6,13(17)-tetraen-14-yl]acetamide (PubChem CID 2045040) has the molecular formula C22H20N2O3S2 and a molecular weight of 424.55 g/mol. Its IUPAC name is N-(2-methylphenyl)-2-[(1R,10S)-15-oxo-8-oxa-12,16-dithia-14-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2,4,6,13(17)-tetraen-14-yl]acetamide.
| Compound Name | N-(2-methylphenyl)-2-[(1R,10S)-15-oxo-8-oxa-12,16-dithia-14-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2,4,6,13(17)-tetraen-14-yl]acetamide |
|---|---|
| PubChem CID | 2045040 |
| Molecular Formula | C22H20N2O3S2 |
| Molecular Weight | 424.55 g/mol |
| Exact Mass | 424.09 |
| IUPAC Name | N-(2-methylphenyl)-2-[(1R,10S)-15-oxo-8-oxa-12,16-dithia-14-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2,4,6,13(17)-tetraen-14-yl]acetamide |
| SMILES | Cc1ccccc1NC(=O)Cn1c2c(sc1=O)[C@H]1c3ccccc3OC[C@H]1CS2 |
| InChI | InChI=1S/C22H20N2O3S2/c1-13-6-2-4-8-16(13)23-18(25)10-24-21-20(29-22(24)26)19-14(12-28-21)11-27-17-9-5-3-7-15(17)19/h2-9,14,19H,10-12H2,1H3,(H,23,25)/t14-,19+/m0/s1 |
| InChIKey | FFBZTKPCJKOEFF-IFXJQAMLSA-N |
| XLogP | 4.10 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.55 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'} |
|---|