C22H19ClN2O3S2 — CID 41180343
N-(4-chlorophenyl)-2-[(1R,10S)-10-methyl-15-oxo-8-oxa-12,16-dithia-14-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2,4,6,13(17)-tetraen-14-yl]acetamide (PubChem CID 41180343) has the molecular formula C22H19ClN2O3S2 and a molecular weight of 458.99 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-[(1R,10S)-10-methyl-15-oxo-8-oxa-12,16-dithia-14-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2,4,6,13(17)-tetraen-14-yl]acetamide.
| Compound Name | N-(4-chlorophenyl)-2-[(1R,10S)-10-methyl-15-oxo-8-oxa-12,16-dithia-14-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2,4,6,13(17)-tetraen-14-yl]acetamide |
|---|---|
| PubChem CID | 41180343 |
| Molecular Formula | C22H19ClN2O3S2 |
| Molecular Weight | 458.99 g/mol |
| Exact Mass | 458.05 |
| IUPAC Name | N-(4-chlorophenyl)-2-[(1R,10S)-10-methyl-15-oxo-8-oxa-12,16-dithia-14-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2,4,6,13(17)-tetraen-14-yl]acetamide |
| SMILES | C[C@@]12COc3ccccc3[C@H]1c1sc(=O)n(CC(=O)Nc3ccc(Cl)cc3)c1SC2 |
| InChI | InChI=1S/C22H19ClN2O3S2/c1-22-11-28-16-5-3-2-4-15(16)18(22)19-20(29-12-22)25(21(27)30-19)10-17(26)24-14-8-6-13(23)7-9-14/h2-9,18H,10-12H2,1H3,(H,24,26)/t18-,22-/m0/s1 |
| InChIKey | BVANEJXGXOAGIA-AVRDEDQJSA-N |
| XLogP | 4.84 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.99 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'} |
|---|