C21H17N3O6S3 — CID 27317358
2-[(1S,10S)-9,15-dioxo-8-oxa-12,16-dithia-14-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2,4,6,13(17)-tetraen-14-yl]-N-(4-sulfamoylphenyl)acetamide (PubChem CID 27317358) has the molecular formula C21H17N3O6S3 and a molecular weight of 503.58 g/mol. Its IUPAC name is 2-[(1S,10S)-9,15-dioxo-8-oxa-12,16-dithia-14-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2,4,6,13(17)-tetraen-14-yl]-N-(4-sulfamoylphenyl)acetamide.
| Compound Name | 2-[(1S,10S)-9,15-dioxo-8-oxa-12,16-dithia-14-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2,4,6,13(17)-tetraen-14-yl]-N-(4-sulfamoylphenyl)acetamide |
|---|---|
| PubChem CID | 27317358 |
| Molecular Formula | C21H17N3O6S3 |
| Molecular Weight | 503.58 g/mol |
| Exact Mass | 503.03 |
| IUPAC Name | 2-[(1S,10S)-9,15-dioxo-8-oxa-12,16-dithia-14-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2,4,6,13(17)-tetraen-14-yl]-N-(4-sulfamoylphenyl)acetamide |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)Cn2c3c(sc2=O)[C@@H]2c4ccccc4OC(=O)[C@H]2CS3)cc1 |
| InChI | InChI=1S/C21H17N3O6S3/c22-33(28,29)12-7-5-11(6-8-12)23-16(25)9-24-19-18(32-21(24)27)17-13-3-1-2-4-15(13)30-20(26)14(17)10-31-19/h1-8,14,17H,9-10H2,(H,23,25)(H2,22,28,29)/t14-,17+/m0/s1 |
| InChIKey | CHKVPCYBFAIFEC-WMLDXEAASA-N |
| XLogP | 1.97 |
| TPSA | 137.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.58 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|