C22H20N2O4S2 — CID 51859410
N-(4-hydroxyphenyl)-3-[(1S,10S)-15-oxo-8-oxa-12,16-dithia-14-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2,4,6,13(17)-tetraen-14-yl]propanamide (PubChem CID 51859410) has the molecular formula C22H20N2O4S2 and a molecular weight of 440.55 g/mol. Its IUPAC name is N-(4-hydroxyphenyl)-3-[(1S,10S)-15-oxo-8-oxa-12,16-dithia-14-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2,4,6,13(17)-tetraen-14-yl]propanamide.
| Compound Name | N-(4-hydroxyphenyl)-3-[(1S,10S)-15-oxo-8-oxa-12,16-dithia-14-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2,4,6,13(17)-tetraen-14-yl]propanamide |
|---|---|
| PubChem CID | 51859410 |
| Molecular Formula | C22H20N2O4S2 |
| Molecular Weight | 440.55 g/mol |
| Exact Mass | 440.09 |
| IUPAC Name | N-(4-hydroxyphenyl)-3-[(1S,10S)-15-oxo-8-oxa-12,16-dithia-14-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2,4,6,13(17)-tetraen-14-yl]propanamide |
| SMILES | O=C(CCn1c2c(sc1=O)[C@@H]1c3ccccc3OC[C@H]1CS2)Nc1ccc(O)cc1 |
| InChI | InChI=1S/C22H20N2O4S2/c25-15-7-5-14(6-8-15)23-18(26)9-10-24-21-20(30-22(24)27)19-13(12-29-21)11-28-17-4-2-1-3-16(17)19/h1-8,13,19,25H,9-12H2,(H,23,26)/t13-,19-/m0/s1 |
| InChIKey | VYMFJTSLHTXXQL-DJJJIMSYSA-N |
| XLogP | 3.89 |
| TPSA | 80.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.55 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|