C23H30Br2O8 — CID 15625178
methyl 3-[2,2-dibromo-3-[[6-methoxy-4-(2-methoxyethoxymethoxy)-7-methyl-3-oxo-1H-2-benzofuran-5-yl]methyl]-1-methylcyclopropyl]propanoate (PubChem CID 15625178) has the molecular formula C23H30Br2O8 and a molecular weight of 594.29 g/mol. Its IUPAC name is methyl 3-[2,2-dibromo-3-[[6-methoxy-4-(2-methoxyethoxymethoxy)-7-methyl-3-oxo-1H-2-benzofuran-5-yl]methyl]-1-methylcyclopropyl]propanoate.
| Compound Name | methyl 3-[2,2-dibromo-3-[[6-methoxy-4-(2-methoxyethoxymethoxy)-7-methyl-3-oxo-1H-2-benzofuran-5-yl]methyl]-1-methylcyclopropyl]propanoate |
|---|---|
| PubChem CID | 15625178 |
| Molecular Formula | C23H30Br2O8 |
| Molecular Weight | 594.29 g/mol |
| Exact Mass | 592.03 |
| IUPAC Name | methyl 3-[2,2-dibromo-3-[[6-methoxy-4-(2-methoxyethoxymethoxy)-7-methyl-3-oxo-1H-2-benzofuran-5-yl]methyl]-1-methylcyclopropyl]propanoate |
| SMILES | COCCOCOc1c(CC2C(Br)(Br)C2(C)CCC(=O)OC)c(OC)c(C)c2c1C(=O)OC2 |
| InChI | InChI=1S/C23H30Br2O8/c1-13-15-11-32-21(27)18(15)20(33-12-31-9-8-28-3)14(19(13)30-5)10-16-22(2,23(16,24)25)7-6-17(26)29-4/h16H,6-12H2,1-5H3 |
| InChIKey | PTFSIZCGBWRCNV-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.29 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|