C46H41O3S2+ — CID 156683379
[4-(7-acetyl-9,9-dimethylfluoren-2-yl)sulfanyl-3-methoxyphenyl]-(9,9-dimethylfluoren-2-yl)-(2-methoxyphenyl)sulfanium (PubChem CID 156683379) has the molecular formula C46H41O3S2+ and a molecular weight of 705.97 g/mol. Its IUPAC name is [4-(7-acetyl-9,9-dimethylfluoren-2-yl)sulfanyl-3-methoxyphenyl]-(9,9-dimethylfluoren-2-yl)-(2-methoxyphenyl)sulfanium.
| Compound Name | [4-(7-acetyl-9,9-dimethylfluoren-2-yl)sulfanyl-3-methoxyphenyl]-(9,9-dimethylfluoren-2-yl)-(2-methoxyphenyl)sulfanium |
|---|---|
| PubChem CID | 156683379 |
| Molecular Formula | C46H41O3S2+ |
| Molecular Weight | 705.97 g/mol |
| Exact Mass | 705.25 |
| IUPAC Name | [4-(7-acetyl-9,9-dimethylfluoren-2-yl)sulfanyl-3-methoxyphenyl]-(9,9-dimethylfluoren-2-yl)-(2-methoxyphenyl)sulfanium |
| SMILES | COc1cc([S+](c2ccc3c(c2)C(C)(C)c2ccccc2-3)c2ccccc2OC)ccc1Sc1ccc2c(c1)C(C)(C)c1cc(C(C)=O)ccc1-2 |
| InChI | InChI=1S/C46H41O3S2/c1-28(47)29-16-20-34-35-21-17-30(25-39(35)46(4,5)38(34)24-29)50-43-23-19-32(27-42(43)49-7)51(44-15-11-10-14-41(44)48-6)31-18-22-36-33-12-8-9-13-37(33)45(2,3)40(36)26-31/h8-27H,1-7H3/q+1 |
| InChIKey | HUYFCCMSOOANFR-UHFFFAOYSA-N |
| XLogP | 11.77 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.97 |
| LogP ≤ 5 | 11.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|