C21H28F2N2O5S — CID 156687881
N-[(1R,15S,19S,20S,21R,22S)-1,20,21,22-tetradeuterio-4,6-difluoro-10-oxo-8,18-dioxa-11-azatetracyclo[17.2.2.02,7.011,16]tricosa-2(7),3,5-trien-15-yl]methanesulfonamide (PubChem CID 156687881) has the molecular formula C21H28F2N2O5S and a molecular weight of 462.55 g/mol. Its IUPAC name is N-[(1R,15S,19S,20S,21R,22S)-1,20,21,22-tetradeuterio-4,6-difluoro-10-oxo-8,18-dioxa-11-azatetracyclo[17.2.2.02,7.011,16]tricosa-2(7),3,5-trien-15-yl]methanesulfonamide.
| Compound Name | N-[(1R,15S,19S,20S,21R,22S)-1,20,21,22-tetradeuterio-4,6-difluoro-10-oxo-8,18-dioxa-11-azatetracyclo[17.2.2.02,7.011,16]tricosa-2(7),3,5-trien-15-yl]methanesulfonamide |
|---|---|
| PubChem CID | 156687881 |
| Molecular Formula | C21H28F2N2O5S |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.19 |
| IUPAC Name | N-[(1R,15S,19S,20S,21R,22S)-1,20,21,22-tetradeuterio-4,6-difluoro-10-oxo-8,18-dioxa-11-azatetracyclo[17.2.2.02,7.011,16]tricosa-2(7),3,5-trien-15-yl]methanesulfonamide |
| SMILES | [2H][C@@H]1[C@@H]2C[C@H]([2H])[C@@]([2H])(c3cc(F)cc(F)c3OCC(=O)N3CCC[C@H](NS(C)(=O)=O)C3CO2)[C@@H]1[2H] |
| InChI | InChI=1S/C21H28F2N2O5S/c1-31(27,28)24-18-3-2-8-25-19(18)11-29-15-6-4-13(5-7-15)16-9-14(22)10-17(23)21(16)30-12-20(25)26/h9-10,13,15,18-19,24H,2-8,11-12H2,1H3/t13-,15+,18-,19?/m0/s1/i4D,5D,6D,13D/t4-,5+,6+,13+,15-,18+,19?/m1 |
| InChIKey | XYDUVAITILHFIU-YVPYBUASSA-N |
| XLogP | 2.31 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |