C12H11ClN2 — CID 156705016
9-chloro-6,7,8,9-tetrahydrobenzo[b][1,8]naphthyridine (PubChem CID 156705016) has the molecular formula C12H11ClN2 and a molecular weight of 218.69 g/mol. Its IUPAC name is 9-chloro-6,7,8,9-tetrahydrobenzo[b][1,8]naphthyridine.
| Compound Name | 9-chloro-6,7,8,9-tetrahydrobenzo[b][1,8]naphthyridine |
|---|---|
| PubChem CID | 156705016 |
| Molecular Formula | C12H11ClN2 |
| Molecular Weight | 218.69 g/mol |
| Exact Mass | 218.06 |
| IUPAC Name | 9-chloro-6,7,8,9-tetrahydrobenzo[b][1,8]naphthyridine |
| SMILES | ClC1CCCc2cc3cccnc3nc21 |
| InChI | InChI=1S/C12H11ClN2/c13-10-5-1-3-8-7-9-4-2-6-14-12(9)15-11(8)10/h2,4,6-7,10H,1,3,5H2 |
| InChIKey | UUKZYSGQXQUABA-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.69 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|