C18H24BrClN2O4 — CID 156707269
tert-butyl N-[1-(3-bromo-5-chloro-2-formylphenyl)-3-(methoxymethyl)pyrrolidin-3-yl]carbamate (PubChem CID 156707269) has the molecular formula C18H24BrClN2O4 and a molecular weight of 447.76 g/mol. Its IUPAC name is tert-butyl N-[1-(3-bromo-5-chloro-2-formylphenyl)-3-(methoxymethyl)pyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-(3-bromo-5-chloro-2-formylphenyl)-3-(methoxymethyl)pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 156707269 |
| Molecular Formula | C18H24BrClN2O4 |
| Molecular Weight | 447.76 g/mol |
| Exact Mass | 446.06 |
| IUPAC Name | tert-butyl N-[1-(3-bromo-5-chloro-2-formylphenyl)-3-(methoxymethyl)pyrrolidin-3-yl]carbamate |
| SMILES | COCC1(NC(=O)OC(C)(C)C)CCN(c2cc(Cl)cc(Br)c2C=O)C1 |
| InChI | InChI=1S/C18H24BrClN2O4/c1-17(2,3)26-16(24)21-18(11-25-4)5-6-22(10-18)15-8-12(20)7-14(19)13(15)9-23/h7-9H,5-6,10-11H2,1-4H3,(H,21,24) |
| InChIKey | RCSYVNOKHNPQJY-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.76 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|