C10H19N3 — CID 156730592
ethene;2-methyl-1-(4-methylpenta-1,3-dien-3-yl)guanidine (PubChem CID 156730592) has the molecular formula C10H19N3 and a molecular weight of 181.28 g/mol. Its IUPAC name is ethene;2-methyl-1-(4-methylpenta-1,3-dien-3-yl)guanidine.
| Compound Name | ethene;2-methyl-1-(4-methylpenta-1,3-dien-3-yl)guanidine |
|---|---|
| PubChem CID | 156730592 |
| Molecular Formula | C10H19N3 |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.16 |
| IUPAC Name | ethene;2-methyl-1-(4-methylpenta-1,3-dien-3-yl)guanidine |
| SMILES | C=C.C=CC(N/C(N)=N/C)=C(C)C |
| InChI | InChI=1S/C8H15N3.C2H4/c1-5-7(6(2)3)11-8(9)10-4;1-2/h5H,1H2,2-4H3,(H3,9,10,11);1-2H2 |
| InChIKey | BIRPEWOHSXVKPU-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|