C15H32N2O4 — CID 156804048
methanol;[5-(2-methylprop-1-enylamino)oxolan-2-yl]methyl 2-aminoacetate;propane (PubChem CID 156804048) has the molecular formula C15H32N2O4 and a molecular weight of 304.43 g/mol. Its IUPAC name is methanol;[5-(2-methylprop-1-enylamino)oxolan-2-yl]methyl 2-aminoacetate;propane.
| Compound Name | methanol;[5-(2-methylprop-1-enylamino)oxolan-2-yl]methyl 2-aminoacetate;propane |
|---|---|
| PubChem CID | 156804048 |
| Molecular Formula | C15H32N2O4 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | methanol;[5-(2-methylprop-1-enylamino)oxolan-2-yl]methyl 2-aminoacetate;propane |
| SMILES | CC(C)=CNC1CCC(COC(=O)CN)O1.CCC.CO |
| InChI | InChI=1S/C11H20N2O3.C3H8.CH4O/c1-8(2)6-13-10-4-3-9(16-10)7-15-11(14)5-12;1-3-2;1-2/h6,9-10,13H,3-5,7,12H2,1-2H3;3H2,1-2H3;2H,1H3 |
| InChIKey | GZWUHIHMLYFWOS-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |