C17H33N3O7 — CID 156804024
[5-[formyl-[(Z)-2-(hydroxymethyl)-3-(methylamino)-3-oxoprop-1-enyl]amino]oxolan-2-yl]methyl 2-aminoacetate;methanol;propane (PubChem CID 156804024) has the molecular formula C17H33N3O7 and a molecular weight of 391.47 g/mol. Its IUPAC name is [5-[formyl-[(Z)-2-(hydroxymethyl)-3-(methylamino)-3-oxoprop-1-enyl]amino]oxolan-2-yl]methyl 2-aminoacetate;methanol;propane.
| Compound Name | [5-[formyl-[(Z)-2-(hydroxymethyl)-3-(methylamino)-3-oxoprop-1-enyl]amino]oxolan-2-yl]methyl 2-aminoacetate;methanol;propane |
|---|---|
| PubChem CID | 156804024 |
| Molecular Formula | C17H33N3O7 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.23 |
| IUPAC Name | [5-[formyl-[(Z)-2-(hydroxymethyl)-3-(methylamino)-3-oxoprop-1-enyl]amino]oxolan-2-yl]methyl 2-aminoacetate;methanol;propane |
| SMILES | CCC.CNC(=O)/C(=C\N(C=O)C1CCC(COC(=O)CN)O1)CO.CO |
| InChI | InChI=1S/C13H21N3O6.C3H8.CH4O/c1-15-13(20)9(6-17)5-16(8-18)11-3-2-10(22-11)7-21-12(19)4-14;1-3-2;1-2/h5,8,10-11,17H,2-4,6-7,14H2,1H3,(H,15,20);3H2,1-2H3;2H,1H3/b9-5-;; |
| InChIKey | YPUVGWFQTDTISG-XDYVNXDCSA-N |
| XLogP | -0.90 |
| TPSA | 151.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|