C15H38N8Re2-2 — CID 157067764
methyl-[[methyl-[[methyl(methylazanidylmethyl)amino]methyl]amino]methyl]azanide;rhenium;1,3,5,7-tetramethyl-1,3,5,7-tetrazocane (PubChem CID 157067764) has the molecular formula C15H38N8Re2-2 and a molecular weight of 702.94 g/mol. Its IUPAC name is methyl-[[methyl-[[methyl(methylazanidylmethyl)amino]methyl]amino]methyl]azanide;rhenium;1,3,5,7-tetramethyl-1,3,5,7-tetrazocane.
| Compound Name | methyl-[[methyl-[[methyl(methylazanidylmethyl)amino]methyl]amino]methyl]azanide;rhenium;1,3,5,7-tetramethyl-1,3,5,7-tetrazocane |
|---|---|
| PubChem CID | 157067764 |
| Molecular Formula | C15H38N8Re2-2 |
| Molecular Weight | 702.94 g/mol |
| Exact Mass | 704.23 |
| IUPAC Name | methyl-[[methyl-[[methyl(methylazanidylmethyl)amino]methyl]amino]methyl]azanide;rhenium;1,3,5,7-tetramethyl-1,3,5,7-tetrazocane |
| SMILES | CN1CN(C)CN(C)CN(C)C1.C[N-]CN(C)CN(C)C[N-]C.[Re].[Re] |
| InChI | InChI=1S/C8H20N4.C7H18N4.2Re/c1-9-5-10(2)7-12(4)8-11(3)6-9;1-8-5-10(3)7-11(4)6-9-2;;/h5-8H2,1-4H3;5-7H2,1-4H3;;/q;-2;; |
| InChIKey | YEDMOOOJZTXUKW-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 47.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.94 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|