C34H48O8 — CID 157137279
tetrakis(benzene-1,3-diol);2,4-dimethylpentane;propane (PubChem CID 157137279) has the molecular formula C34H48O8 and a molecular weight of 584.75 g/mol. Its IUPAC name is tetrakis(benzene-1,3-diol);2,4-dimethylpentane;propane.
| Compound Name | tetrakis(benzene-1,3-diol);2,4-dimethylpentane;propane |
|---|---|
| PubChem CID | 157137279 |
| Molecular Formula | C34H48O8 |
| Molecular Weight | 584.75 g/mol |
| Exact Mass | 584.33 |
| IUPAC Name | tetrakis(benzene-1,3-diol);2,4-dimethylpentane;propane |
| SMILES | CC(C)CC(C)C.CCC.Oc1cccc(O)c1.Oc1cccc(O)c1.Oc1cccc(O)c1.Oc1cccc(O)c1 |
| InChI | InChI=1S/C7H16.4C6H6O2.C3H8/c1-6(2)5-7(3)4;4*7-5-2-1-3-6(8)4-5;1-3-2/h6-7H,5H2,1-4H3;4*1-4,7-8H;3H2,1-2H3 |
| InChIKey | AJTORNRKCJCDFZ-UHFFFAOYSA-N |
| XLogP | 8.50 |
| TPSA | 161.84 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.75 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |