C22H20Cl3NO4 — CID 15715389
3-(6-ethenyl-1,3-benzodioxol-5-yl)-7,8-dimethoxy-2-methyl-1-(trichloromethyl)-1H-isoquinoline (PubChem CID 15715389) has the molecular formula C22H20Cl3NO4 and a molecular weight of 468.76 g/mol. Its IUPAC name is 3-(6-ethenyl-1,3-benzodioxol-5-yl)-7,8-dimethoxy-2-methyl-1-(trichloromethyl)-1H-isoquinoline.
| Compound Name | 3-(6-ethenyl-1,3-benzodioxol-5-yl)-7,8-dimethoxy-2-methyl-1-(trichloromethyl)-1H-isoquinoline |
|---|---|
| PubChem CID | 15715389 |
| Molecular Formula | C22H20Cl3NO4 |
| Molecular Weight | 468.76 g/mol |
| Exact Mass | 467.05 |
| IUPAC Name | 3-(6-ethenyl-1,3-benzodioxol-5-yl)-7,8-dimethoxy-2-methyl-1-(trichloromethyl)-1H-isoquinoline |
| SMILES | C=Cc1cc2c(cc1C1=Cc3ccc(OC)c(OC)c3C(C(Cl)(Cl)Cl)N1C)OCO2 |
| InChI | InChI=1S/C22H20Cl3NO4/c1-5-12-9-17-18(30-11-29-17)10-14(12)15-8-13-6-7-16(27-3)20(28-4)19(13)21(26(15)2)22(23,24)25/h5-10,21H,1,11H2,2-4H3 |
| InChIKey | AVIJTELXVHDYKA-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.76 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|