About 2-hydroxypropanoic acid;quinazoline
2-hydroxypropanoic acid;quinazoline (PubChem CID 157213189) has the molecular formula C11H12N2O3
and a molecular weight of 220.23 g/mol. Its IUPAC name is 2-hydroxypropanoic acid;quinazoline.
Molecular Properties
| Compound Name | 2-hydroxypropanoic acid;quinazoline |
| PubChem CID | 157213189 |
| Molecular Formula | C11H12N2O3 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | 2-hydroxypropanoic acid;quinazoline |
| SMILES | CC(O)C(=O)O.c1ccc2ncncc2c1 |
| InChI | InChI=1S/C8H6N2.C3H6O3/c1-2-4-8-7(3-1)5-9-6-10-8;1-2(4)3(5)6/h1-6H;2,4H,1H3,(H,5,6) |
| InChIKey | ASCUMSIYSJXTSL-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 83.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-hydroxypropanoic acid;quinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxypropanoic acid;quinazoline?
The IUPAC name of 2-hydroxypropanoic acid;quinazoline (CID 157213189) is 2-hydroxypropanoic acid;quinazoline.
What is the SMILES notation for 2-hydroxypropanoic acid;quinazoline?
The canonical SMILES for 2-hydroxypropanoic acid;quinazoline is CC(O)C(=O)O.c1ccc2ncncc2c1.
What is the InChIKey of 2-hydroxypropanoic acid;quinazoline?
The InChIKey is ASCUMSIYSJXTSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2.C3H6O3/c1-2-4-8-7(3-1)5-9-6-10-8;1-2(4)3(5)6/h1-6H;2,4H,1H3,(H,5,6).
What are the key properties of 2-hydroxypropanoic acid;quinazoline?
2-hydroxypropanoic acid;quinazoline has a molecular weight of 220.23 g/mol, XLogP of 1.08, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxypropanoic acid;quinazoline is sourced from PubChem (CID 157213189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).