About pyridine;quinazoline;hydrofluoride
pyridine;quinazoline;hydrofluoride (PubChem CID 159567796) has the molecular formula C13H12FN3
and a molecular weight of 229.26 g/mol. Its IUPAC name is pyridine;quinazoline;hydrofluoride.
Molecular Properties
| Compound Name | pyridine;quinazoline;hydrofluoride |
| PubChem CID | 159567796 |
| Molecular Formula | C13H12FN3 |
| Molecular Weight | 229.26 g/mol |
| Exact Mass | 229.10 |
| IUPAC Name | pyridine;quinazoline;hydrofluoride |
| SMILES | F.c1ccc2ncncc2c1.c1ccncc1 |
| InChI | InChI=1S/C8H6N2.C5H5N.FH/c1-2-4-8-7(3-1)5-9-6-10-8;1-2-4-6-5-3-1;/h1-6H;1-5H;1H |
| InChIKey | BTXXCXNAUZJHMM-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.26 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze pyridine;quinazoline;hydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridine;quinazoline;hydrofluoride?
The IUPAC name of pyridine;quinazoline;hydrofluoride (CID 159567796) is pyridine;quinazoline;hydrofluoride.
What is the SMILES notation for pyridine;quinazoline;hydrofluoride?
The canonical SMILES for pyridine;quinazoline;hydrofluoride is F.c1ccc2ncncc2c1.c1ccncc1.
What is the InChIKey of pyridine;quinazoline;hydrofluoride?
The InChIKey is BTXXCXNAUZJHMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2.C5H5N.FH/c1-2-4-8-7(3-1)5-9-6-10-8;1-2-4-6-5-3-1;/h1-6H;1-5H;1H.
What are the key properties of pyridine;quinazoline;hydrofluoride?
pyridine;quinazoline;hydrofluoride has a molecular weight of 229.26 g/mol, XLogP of 2.86, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pyridine;quinazoline;hydrofluoride is sourced from PubChem (CID 159567796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).