About 2,1-benzothiazole;quinazoline
2,1-benzothiazole;quinazoline (PubChem CID 145320674) has the molecular formula C15H11N3S
and a molecular weight of 265.34 g/mol. Its IUPAC name is 2,1-benzothiazole;quinazoline.
Molecular Properties
| Compound Name | 2,1-benzothiazole;quinazoline |
| PubChem CID | 145320674 |
| Molecular Formula | C15H11N3S |
| Molecular Weight | 265.34 g/mol |
| Exact Mass | 265.07 |
| IUPAC Name | 2,1-benzothiazole;quinazoline |
| SMILES | c1ccc2ncncc2c1.c1ccc2nscc2c1 |
| InChI | InChI=1S/C8H6N2.C7H5NS/c1-2-4-8-7(3-1)5-9-6-10-8;1-2-4-7-6(3-1)5-9-8-7/h1-6H;1-5H |
| InChIKey | MGTDWEYJLSRMSJ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.34 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,1-benzothiazole;quinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,1-benzothiazole;quinazoline?
The IUPAC name of 2,1-benzothiazole;quinazoline (CID 145320674) is 2,1-benzothiazole;quinazoline.
What is the SMILES notation for 2,1-benzothiazole;quinazoline?
The canonical SMILES for 2,1-benzothiazole;quinazoline is c1ccc2ncncc2c1.c1ccc2nscc2c1.
What is the InChIKey of 2,1-benzothiazole;quinazoline?
The InChIKey is MGTDWEYJLSRMSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2.C7H5NS/c1-2-4-8-7(3-1)5-9-6-10-8;1-2-4-7-6(3-1)5-9-8-7/h1-6H;1-5H.
What are the key properties of 2,1-benzothiazole;quinazoline?
2,1-benzothiazole;quinazoline has a molecular weight of 265.34 g/mol, XLogP of 3.93, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,1-benzothiazole;quinazoline is sourced from PubChem (CID 145320674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).