About 1,2-dihydrocinnoline;quinazoline
1,2-dihydrocinnoline;quinazoline (PubChem CID 177193666) has the molecular formula C16H14N4
and a molecular weight of 262.32 g/mol. Its IUPAC name is 1,2-dihydrocinnoline;quinazoline.
Molecular Properties
| Compound Name | 1,2-dihydrocinnoline;quinazoline |
| PubChem CID | 177193666 |
| Molecular Formula | C16H14N4 |
| Molecular Weight | 262.32 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | 1,2-dihydrocinnoline;quinazoline |
| SMILES | C1=Cc2ccccc2NN1.c1ccc2ncncc2c1 |
| InChI | InChI=1S/C8H6N2.C8H8N2/c1-2-4-8-7(3-1)5-9-6-10-8;1-2-4-8-7(3-1)5-6-9-10-8/h1-6H;1-6,9-10H |
| InChIKey | KBVBPAQBTSHDDW-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.32 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1,2-dihydrocinnoline;quinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dihydrocinnoline;quinazoline?
The IUPAC name of 1,2-dihydrocinnoline;quinazoline (CID 177193666) is 1,2-dihydrocinnoline;quinazoline.
What is the SMILES notation for 1,2-dihydrocinnoline;quinazoline?
The canonical SMILES for 1,2-dihydrocinnoline;quinazoline is C1=Cc2ccccc2NN1.c1ccc2ncncc2c1.
What is the InChIKey of 1,2-dihydrocinnoline;quinazoline?
The InChIKey is KBVBPAQBTSHDDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2.C8H8N2/c1-2-4-8-7(3-1)5-9-6-10-8;1-2-4-8-7(3-1)5-6-9-10-8/h1-6H;1-6,9-10H.
What are the key properties of 1,2-dihydrocinnoline;quinazoline?
1,2-dihydrocinnoline;quinazoline has a molecular weight of 262.32 g/mol, XLogP of 3.22, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dihydrocinnoline;quinazoline is sourced from PubChem (CID 177193666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).