About 1H-pyrazole;quinazoline
1H-pyrazole;quinazoline (PubChem CID 157207291) has the molecular formula C11H10N4
and a molecular weight of 198.23 g/mol. Its IUPAC name is 1H-pyrazole;quinazoline.
Molecular Properties
| Compound Name | 1H-pyrazole;quinazoline |
| PubChem CID | 157207291 |
| Molecular Formula | C11H10N4 |
| Molecular Weight | 198.23 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | 1H-pyrazole;quinazoline |
| SMILES | c1ccc2ncncc2c1.c1cn[nH]c1 |
| InChI | InChI=1S/C8H6N2.C3H4N2/c1-2-4-8-7(3-1)5-9-6-10-8;1-2-4-5-3-1/h1-6H;1-3H,(H,4,5) |
| InChIKey | ARMQQOXIHQRINP-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.23 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1H-pyrazole;quinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-pyrazole;quinazoline?
The IUPAC name of 1H-pyrazole;quinazoline (CID 157207291) is 1H-pyrazole;quinazoline.
What is the SMILES notation for 1H-pyrazole;quinazoline?
The canonical SMILES for 1H-pyrazole;quinazoline is c1ccc2ncncc2c1.c1cn[nH]c1.
What is the InChIKey of 1H-pyrazole;quinazoline?
The InChIKey is ARMQQOXIHQRINP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2.C3H4N2/c1-2-4-8-7(3-1)5-9-6-10-8;1-2-4-5-3-1/h1-6H;1-3H,(H,4,5).
What are the key properties of 1H-pyrazole;quinazoline?
1H-pyrazole;quinazoline has a molecular weight of 198.23 g/mol, XLogP of 2.04, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-pyrazole;quinazoline is sourced from PubChem (CID 157207291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).