About N,N-dimethylnitramide;quinazoline
N,N-dimethylnitramide;quinazoline (PubChem CID 18176213) has the molecular formula C10H12N4O2
and a molecular weight of 220.23 g/mol. Its IUPAC name is N,N-dimethylnitramide;quinazoline.
Molecular Properties
| Compound Name | N,N-dimethylnitramide;quinazoline |
| PubChem CID | 18176213 |
| Molecular Formula | C10H12N4O2 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | N,N-dimethylnitramide;quinazoline |
| SMILES | CN(C)[N+](=O)[O-].c1ccc2ncncc2c1 |
| InChI | InChI=1S/C8H6N2.C2H6N2O2/c1-2-4-8-7(3-1)5-9-6-10-8;1-3(2)4(5)6/h1-6H;1-2H3 |
| InChIKey | MVIXKNHEEVVGQK-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 72.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethylnitramide;quinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylnitramide;quinazoline?
The IUPAC name of N,N-dimethylnitramide;quinazoline (CID 18176213) is N,N-dimethylnitramide;quinazoline.
What is the SMILES notation for N,N-dimethylnitramide;quinazoline?
The canonical SMILES for N,N-dimethylnitramide;quinazoline is CN(C)[N+](=O)[O-].c1ccc2ncncc2c1.
What is the InChIKey of N,N-dimethylnitramide;quinazoline?
The InChIKey is MVIXKNHEEVVGQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2.C2H6N2O2/c1-2-4-8-7(3-1)5-9-6-10-8;1-3(2)4(5)6/h1-6H;1-2H3.
What are the key properties of N,N-dimethylnitramide;quinazoline?
N,N-dimethylnitramide;quinazoline has a molecular weight of 220.23 g/mol, XLogP of 1.37, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylnitramide;quinazoline is sourced from PubChem (CID 18176213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).