About cumene;N-ethylhydroxylamine
cumene;N-ethylhydroxylamine (PubChem CID 157267693) has the molecular formula C11H19NO
and a molecular weight of 181.28 g/mol. Its IUPAC name is cumene;N-ethylhydroxylamine.
Molecular Properties
| Compound Name | cumene;N-ethylhydroxylamine |
| PubChem CID | 157267693 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | cumene;N-ethylhydroxylamine |
| SMILES | CC(C)c1ccccc1.CCNO |
| InChI | InChI=1S/C9H12.C2H7NO/c1-8(2)9-6-4-3-5-7-9;1-2-3-4/h3-8H,1-2H3;3-4H,2H2,1H3 |
| InChIKey | AYEKJWMPCPRTGJ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze cumene;N-ethylhydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cumene;N-ethylhydroxylamine?
The IUPAC name of cumene;N-ethylhydroxylamine (CID 157267693) is cumene;N-ethylhydroxylamine.
What is the SMILES notation for cumene;N-ethylhydroxylamine?
The canonical SMILES for cumene;N-ethylhydroxylamine is CC(C)c1ccccc1.CCNO.
What is the InChIKey of cumene;N-ethylhydroxylamine?
The InChIKey is AYEKJWMPCPRTGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12.C2H7NO/c1-8(2)9-6-4-3-5-7-9;1-2-3-4/h3-8H,1-2H3;3-4H,2H2,1H3.
What are the key properties of cumene;N-ethylhydroxylamine?
cumene;N-ethylhydroxylamine has a molecular weight of 181.28 g/mol, XLogP of 2.80, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cumene;N-ethylhydroxylamine is sourced from PubChem (CID 157267693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).