C30H39NO9S — CID 157319519
4-[3-[4-[[(3R,4S,5S,6R)-5-methoxy-4-[(2S,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl]oxy]-2,4-dioxobutyl]sulfanylanilino]-4-oxobutanoic acid (PubChem CID 157319519) has the molecular formula C30H39NO9S and a molecular weight of 589.71 g/mol. Its IUPAC name is 4-[3-[4-[[(3R,4S,5S,6R)-5-methoxy-4-[(2S,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl]oxy]-2,4-dioxobutyl]sulfanylanilino]-4-oxobutanoic acid.
| Compound Name | 4-[3-[4-[[(3R,4S,5S,6R)-5-methoxy-4-[(2S,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl]oxy]-2,4-dioxobutyl]sulfanylanilino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 157319519 |
| Molecular Formula | C30H39NO9S |
| Molecular Weight | 589.71 g/mol |
| Exact Mass | 589.23 |
| IUPAC Name | 4-[3-[4-[[(3R,4S,5S,6R)-5-methoxy-4-[(2S,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl]oxy]-2,4-dioxobutyl]sulfanylanilino]-4-oxobutanoic acid |
| SMILES | CO[C@@H]1[C@H](OC(=O)CC(=O)CSc2cccc(NC(=O)CCC(=O)O)c2)CC[C@]2(CO2)[C@H]1[C@]1(C)O[C@@H]1CC=C(C)C |
| InChI | InChI=1S/C30H39NO9S/c1-18(2)8-9-23-29(3,40-23)28-27(37-4)22(12-13-30(28)17-38-30)39-26(36)15-20(32)16-41-21-7-5-6-19(14-21)31-24(33)10-11-25(34)35/h5-8,14,22-23,27-28H,9-13,15-17H2,1-4H3,(H,31,33)(H,34,35)/t22-,23-,27-,28-,29-,30+/m1/s1 |
| InChIKey | OBBSFIBSTVGPSU-VIFJTDLLSA-N |
| XLogP | 4.16 |
| TPSA | 144.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.71 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|