C35H41N5O5 — CID 157328556
tert-butyl 6-[[5-[4-anilino-7-methoxy-3-(methylcarbamoyl)quinolin-6-yl]pyridine-2-carbonyl]-methylamino]hexanoate (PubChem CID 157328556) has the molecular formula C35H41N5O5 and a molecular weight of 611.74 g/mol. Its IUPAC name is tert-butyl 6-[[5-[4-anilino-7-methoxy-3-(methylcarbamoyl)quinolin-6-yl]pyridine-2-carbonyl]-methylamino]hexanoate.
| Compound Name | tert-butyl 6-[[5-[4-anilino-7-methoxy-3-(methylcarbamoyl)quinolin-6-yl]pyridine-2-carbonyl]-methylamino]hexanoate |
|---|---|
| PubChem CID | 157328556 |
| Molecular Formula | C35H41N5O5 |
| Molecular Weight | 611.74 g/mol |
| Exact Mass | 611.31 |
| IUPAC Name | tert-butyl 6-[[5-[4-anilino-7-methoxy-3-(methylcarbamoyl)quinolin-6-yl]pyridine-2-carbonyl]-methylamino]hexanoate |
| SMILES | CNC(=O)c1cnc2cc(OC)c(-c3ccc(C(=O)N(C)CCCCCC(=O)OC(C)(C)C)nc3)cc2c1Nc1ccccc1 |
| InChI | InChI=1S/C35H41N5O5/c1-35(2,3)45-31(41)15-11-8-12-18-40(5)34(43)28-17-16-23(21-37-28)25-19-26-29(20-30(25)44-6)38-22-27(33(42)36-4)32(26)39-24-13-9-7-10-14-24/h7,9-10,13-14,16-17,19-22H,8,11-12,15,18H2,1-6H3,(H,36,42)(H,38,39) |
| InChIKey | UPYLFJQQYREDMS-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 122.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.74 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|