About 4-chloro-1,3-benzothiazole;quinoline
4-chloro-1,3-benzothiazole;quinoline (PubChem CID 157349883) has the molecular formula C16H11ClN2S
and a molecular weight of 298.80 g/mol. Its IUPAC name is 4-chloro-1,3-benzothiazole;quinoline.
Molecular Properties
| Compound Name | 4-chloro-1,3-benzothiazole;quinoline |
| PubChem CID | 157349883 |
| Molecular Formula | C16H11ClN2S |
| Molecular Weight | 298.80 g/mol |
| Exact Mass | 298.03 |
| IUPAC Name | 4-chloro-1,3-benzothiazole;quinoline |
| SMILES | Clc1cccc2scnc12.c1ccc2ncccc2c1 |
| InChI | InChI=1S/C9H7N.C7H4ClNS/c1-2-6-9-8(4-1)5-3-7-10-9;8-5-2-1-3-6-7(5)9-4-10-6/h1-7H;1-4H |
| InChIKey | BHKDSYSWLLBVLF-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 298.80 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-chloro-1,3-benzothiazole;quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-1,3-benzothiazole;quinoline?
The IUPAC name of 4-chloro-1,3-benzothiazole;quinoline (CID 157349883) is 4-chloro-1,3-benzothiazole;quinoline.
What is the SMILES notation for 4-chloro-1,3-benzothiazole;quinoline?
The canonical SMILES for 4-chloro-1,3-benzothiazole;quinoline is Clc1cccc2scnc12.c1ccc2ncccc2c1.
What is the InChIKey of 4-chloro-1,3-benzothiazole;quinoline?
The InChIKey is BHKDSYSWLLBVLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N.C7H4ClNS/c1-2-6-9-8(4-1)5-3-7-10-9;8-5-2-1-3-6-7(5)9-4-10-6/h1-7H;1-4H.
What are the key properties of 4-chloro-1,3-benzothiazole;quinoline?
4-chloro-1,3-benzothiazole;quinoline has a molecular weight of 298.80 g/mol, XLogP of 5.18, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-1,3-benzothiazole;quinoline is sourced from PubChem (CID 157349883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).