C17H18N2O4 — CID 158002105
5,12-di(propan-2-yl)-5,12-diazatricyclo[8.3.0.03,7]trideca-1(10),2,7-triene-4,6,11,13-tetrone (PubChem CID 158002105) has the molecular formula C17H18N2O4 and a molecular weight of 314.34 g/mol. Its IUPAC name is 5,12-di(propan-2-yl)-5,12-diazatricyclo[8.3.0.03,7]trideca-1(10),2,7-triene-4,6,11,13-tetrone.
| Compound Name | 5,12-di(propan-2-yl)-5,12-diazatricyclo[8.3.0.03,7]trideca-1(10),2,7-triene-4,6,11,13-tetrone |
|---|---|
| PubChem CID | 158002105 |
| Molecular Formula | C17H18N2O4 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | 5,12-di(propan-2-yl)-5,12-diazatricyclo[8.3.0.03,7]trideca-1(10),2,7-triene-4,6,11,13-tetrone |
| SMILES | CC(C)N1C(=O)C2=CCC3=C(C=C2C1=O)C(=O)N(C(C)C)C3=O |
| InChI | InChI=1S/C17H18N2O4/c1-8(2)18-14(20)10-5-6-11-13(7-12(10)16(18)22)17(23)19(9(3)4)15(11)21/h5,7-9H,6H2,1-4H3 |
| InChIKey | FDVYAGRSSJRABG-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|