About butanoate;trimethylsulfanium
butanoate;trimethylsulfanium (PubChem CID 158016231) has the molecular formula C7H16O2S
and a molecular weight of 164.27 g/mol. Its IUPAC name is butanoate;trimethylsulfanium.
Molecular Properties
| Compound Name | butanoate;trimethylsulfanium |
| PubChem CID | 158016231 |
| Molecular Formula | C7H16O2S |
| Molecular Weight | 164.27 g/mol |
| Exact Mass | 164.09 |
| IUPAC Name | butanoate;trimethylsulfanium |
| SMILES | CCCC(=O)[O-].C[S+](C)C |
| InChI | InChI=1S/C4H8O2.C3H9S/c1-2-3-4(5)6;1-4(2)3/h2-3H2,1H3,(H,5,6);1-3H3/q;+1/p-1 |
| InChIKey | FFMQOYFFPVCBGH-UHFFFAOYSA-M |
| XLogP | 0.03 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.27 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze butanoate;trimethylsulfanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butanoate;trimethylsulfanium?
The IUPAC name of butanoate;trimethylsulfanium (CID 158016231) is butanoate;trimethylsulfanium.
What is the SMILES notation for butanoate;trimethylsulfanium?
The canonical SMILES for butanoate;trimethylsulfanium is CCCC(=O)[O-].C[S+](C)C.
What is the InChIKey of butanoate;trimethylsulfanium?
The InChIKey is FFMQOYFFPVCBGH-UHFFFAOYSA-M. The full InChI is InChI=1S/C4H8O2.C3H9S/c1-2-3-4(5)6;1-4(2)3/h2-3H2,1H3,(H,5,6);1-3H3/q;+1/p-1.
What are the key properties of butanoate;trimethylsulfanium?
butanoate;trimethylsulfanium has a molecular weight of 164.27 g/mol, XLogP of 0.03, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butanoate;trimethylsulfanium is sourced from PubChem (CID 158016231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).