C29H35FO6 — CID 158041058
[(1S,4S,5S,6R,9S,10R,12R,14R)-5,6-dihydroxy-7-(hydroxymethyl)-3,11,11,14-tetramethyl-15-oxo-4-tetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dienyl] 2-ethyl-6-fluorobenzoate (PubChem CID 158041058) has the molecular formula C29H35FO6 and a molecular weight of 498.59 g/mol. Its IUPAC name is [(1S,4S,5S,6R,9S,10R,12R,14R)-5,6-dihydroxy-7-(hydroxymethyl)-3,11,11,14-tetramethyl-15-oxo-4-tetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dienyl] 2-ethyl-6-fluorobenzoate.
| Compound Name | [(1S,4S,5S,6R,9S,10R,12R,14R)-5,6-dihydroxy-7-(hydroxymethyl)-3,11,11,14-tetramethyl-15-oxo-4-tetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dienyl] 2-ethyl-6-fluorobenzoate |
|---|---|
| PubChem CID | 158041058 |
| Molecular Formula | C29H35FO6 |
| Molecular Weight | 498.59 g/mol |
| Exact Mass | 498.24 |
| IUPAC Name | [(1S,4S,5S,6R,9S,10R,12R,14R)-5,6-dihydroxy-7-(hydroxymethyl)-3,11,11,14-tetramethyl-15-oxo-4-tetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dienyl] 2-ethyl-6-fluorobenzoate |
| SMILES | CCc1cccc(F)c1C(=O)O[C@H]1C(C)=C[C@]23C(=O)[C@@H](C=C(CO)[C@@H](O)[C@]12O)[C@H]1[C@@H](C[C@H]3C)C1(C)C |
| InChI | InChI=1S/C29H35FO6/c1-6-16-8-7-9-20(30)21(16)26(34)36-25-14(2)12-28-15(3)10-19-22(27(19,4)5)18(24(28)33)11-17(13-31)23(32)29(25,28)35/h7-9,11-12,15,18-19,22-23,25,31-32,35H,6,10,13H2,1-5H3/t15-,18+,19-,22+,23-,25+,28+,29+/m1/s1 |
| InChIKey | FIIXJLCRBHCZTN-QHLPNTCGSA-N |
| XLogP | 3.38 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.59 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|