C28H35NO7 — CID 72946076
[(1R,4S,5S,6R,9S,10R,12R,14R)-5,6-dihydroxy-7-(hydroxymethyl)-3,11,11,14-tetramethyl-15-oxo-4-tetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dienyl] 2-amino-6-methoxybenzoate (PubChem CID 72946076) has the molecular formula C28H35NO7 and a molecular weight of 497.59 g/mol. Its IUPAC name is [(1R,4S,5S,6R,9S,10R,12R,14R)-5,6-dihydroxy-7-(hydroxymethyl)-3,11,11,14-tetramethyl-15-oxo-4-tetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dienyl] 2-amino-6-methoxybenzoate.
| Compound Name | [(1R,4S,5S,6R,9S,10R,12R,14R)-5,6-dihydroxy-7-(hydroxymethyl)-3,11,11,14-tetramethyl-15-oxo-4-tetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dienyl] 2-amino-6-methoxybenzoate |
|---|---|
| PubChem CID | 72946076 |
| Molecular Formula | C28H35NO7 |
| Molecular Weight | 497.59 g/mol |
| Exact Mass | 497.24 |
| IUPAC Name | [(1R,4S,5S,6R,9S,10R,12R,14R)-5,6-dihydroxy-7-(hydroxymethyl)-3,11,11,14-tetramethyl-15-oxo-4-tetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dienyl] 2-amino-6-methoxybenzoate |
| SMILES | COc1cccc(N)c1C(=O)O[C@H]1C(C)=C[C@@]23C(=O)[C@@H](C=C(CO)[C@@H](O)[C@]12O)[C@H]1[C@@H](C[C@H]3C)C1(C)C |
| InChI | InChI=1S/C28H35NO7/c1-13-11-27-14(2)9-17-21(26(17,3)4)16(23(27)32)10-15(12-30)22(31)28(27,34)24(13)36-25(33)20-18(29)7-6-8-19(20)35-5/h6-8,10-11,14,16-17,21-22,24,30-31,34H,9,12,29H2,1-5H3/t14-,16+,17-,21+,22-,24+,27-,28+/m1/s1 |
| InChIKey | VZSUJGJGPSXMHB-BVILSJADSA-N |
| XLogP | 2.27 |
| TPSA | 139.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.59 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|