C16H21N9O5 — CID 158078420
[(2S,3S,6R)-4,6-diazido-3-[[(2S,4S)-3-azido-6-formyl-4-methyl-3,4-dihydro-2H-pyran-2-yl]oxy]-2-methylcyclohexyl] acetate (PubChem CID 158078420) has the molecular formula C16H21N9O5 and a molecular weight of 419.40 g/mol. Its IUPAC name is [(2S,3S,6R)-4,6-diazido-3-[[(2S,4S)-3-azido-6-formyl-4-methyl-3,4-dihydro-2H-pyran-2-yl]oxy]-2-methylcyclohexyl] acetate.
| Compound Name | [(2S,3S,6R)-4,6-diazido-3-[[(2S,4S)-3-azido-6-formyl-4-methyl-3,4-dihydro-2H-pyran-2-yl]oxy]-2-methylcyclohexyl] acetate |
|---|---|
| PubChem CID | 158078420 |
| Molecular Formula | C16H21N9O5 |
| Molecular Weight | 419.40 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | [(2S,3S,6R)-4,6-diazido-3-[[(2S,4S)-3-azido-6-formyl-4-methyl-3,4-dihydro-2H-pyran-2-yl]oxy]-2-methylcyclohexyl] acetate |
| SMILES | CC(=O)OC1[C@@H](C)[C@H](O[C@H]2OC(C=O)=C[C@H](C)C2N=[N+]=[N-])C(N=[N+]=[N-])C[C@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C16H21N9O5/c1-7-4-10(6-26)29-16(13(7)22-25-19)30-15-8(2)14(28-9(3)27)11(20-23-17)5-12(15)21-24-18/h4,6-8,11-16H,5H2,1-3H3/t7-,8+,11+,12?,13?,14?,15-,16+/m0/s1 |
| InChIKey | BVEYEINZUKLEJT-SPSOLIQMSA-N |
| XLogP | 3.45 |
| TPSA | 208.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.40 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|