C56H50N2 — CID 158127359
10-[4-(4,6-diphenyl-2-pyridinyl)-2,6-diphenylphenyl]-1,2,3,4,5,6,7,8-octamethyl-9H-acridine (PubChem CID 158127359) has the molecular formula C56H50N2 and a molecular weight of 751.03 g/mol. Its IUPAC name is 10-[4-(4,6-diphenyl-2-pyridinyl)-2,6-diphenylphenyl]-1,2,3,4,5,6,7,8-octamethyl-9H-acridine.
| Compound Name | 10-[4-(4,6-diphenyl-2-pyridinyl)-2,6-diphenylphenyl]-1,2,3,4,5,6,7,8-octamethyl-9H-acridine |
|---|---|
| PubChem CID | 158127359 |
| Molecular Formula | C56H50N2 |
| Molecular Weight | 751.03 g/mol |
| Exact Mass | 750.40 |
| IUPAC Name | 10-[4-(4,6-diphenyl-2-pyridinyl)-2,6-diphenylphenyl]-1,2,3,4,5,6,7,8-octamethyl-9H-acridine |
| SMILES | Cc1c(C)c(C)c2c(c1C)Cc1c(C)c(C)c(C)c(C)c1N2c1c(-c2ccccc2)cc(-c2cc(-c3ccccc3)cc(-c3ccccc3)n2)cc1-c1ccccc1 |
| InChI | InChI=1S/C56H50N2/c1-34-36(3)40(7)54-48(38(34)5)33-49-39(6)35(2)37(4)41(8)55(49)58(54)56-50(43-23-15-10-16-24-43)29-47(30-51(56)44-25-17-11-18-26-44)53-32-46(42-21-13-9-14-22-42)31-52(57-53)45-27-19-12-20-28-45/h9-32H,33H2,1-8H3 |
| InChIKey | BPIIYNRLIHMQSZ-UHFFFAOYSA-N |
| XLogP | 15.26 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.03 |
| LogP ≤ 5 | 15.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |