About N-aminocarbamate;1H-imidazol-3-ium
N-aminocarbamate;1H-imidazol-3-ium (PubChem CID 158208230) has the molecular formula C4H8N4O2
and a molecular weight of 144.13 g/mol. Its IUPAC name is N-aminocarbamate;1H-imidazol-3-ium.
Molecular Properties
| Compound Name | N-aminocarbamate;1H-imidazol-3-ium |
| PubChem CID | 158208230 |
| Molecular Formula | C4H8N4O2 |
| Molecular Weight | 144.13 g/mol |
| Exact Mass | 144.06 |
| IUPAC Name | N-aminocarbamate;1H-imidazol-3-ium |
| SMILES | NNC(=O)[O-].c1c[nH+]c[nH]1 |
| InChI | InChI=1S/C3H4N2.CH4N2O2/c1-2-5-3-4-1;2-3-1(4)5/h1-3H,(H,4,5);3H,2H2,(H,4,5) |
| InChIKey | GBTGOBAJCMRGDM-UHFFFAOYSA-N |
| XLogP | -2.38 |
| TPSA | 108.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.13 |
| LogP ≤ 5 | -2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-aminocarbamate;1H-imidazol-3-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-aminocarbamate;1H-imidazol-3-ium?
The IUPAC name of N-aminocarbamate;1H-imidazol-3-ium (CID 158208230) is N-aminocarbamate;1H-imidazol-3-ium.
What is the SMILES notation for N-aminocarbamate;1H-imidazol-3-ium?
The canonical SMILES for N-aminocarbamate;1H-imidazol-3-ium is NNC(=O)[O-].c1c[nH+]c[nH]1.
What is the InChIKey of N-aminocarbamate;1H-imidazol-3-ium?
The InChIKey is GBTGOBAJCMRGDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4N2.CH4N2O2/c1-2-5-3-4-1;2-3-1(4)5/h1-3H,(H,4,5);3H,2H2,(H,4,5).
What are the key properties of N-aminocarbamate;1H-imidazol-3-ium?
N-aminocarbamate;1H-imidazol-3-ium has a molecular weight of 144.13 g/mol, XLogP of -2.38, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-aminocarbamate;1H-imidazol-3-ium is sourced from PubChem (CID 158208230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).