About sodium N-aminocarbamate
sodium N-aminocarbamate (PubChem CID 23710633) has the molecular formula CH3N2NaO2
and a molecular weight of 98.04 g/mol. Its IUPAC name is sodium N-aminocarbamate.
Molecular Properties
| Compound Name | sodium N-aminocarbamate |
| PubChem CID | 23710633 |
| Molecular Formula | CH3N2NaO2 |
| Molecular Weight | 98.04 g/mol |
| Exact Mass | 98.01 |
| IUPAC Name | sodium N-aminocarbamate |
| SMILES | NNC(=O)[O-].[Na+] |
| InChI | InChI=1S/CH4N2O2.Na/c2-3-1(4)5;/h3H,2H2,(H,4,5);/q;+1/p-1 |
| InChIKey | CGHQUHYDOFAJFI-UHFFFAOYSA-M |
| XLogP | -5.20 |
| TPSA | 78.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 98.04 |
| LogP ≤ 5 | -5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze sodium N-aminocarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium N-aminocarbamate?
The IUPAC name of sodium N-aminocarbamate (CID 23710633) is sodium N-aminocarbamate.
What is the SMILES notation for sodium N-aminocarbamate?
The canonical SMILES for sodium N-aminocarbamate is NNC(=O)[O-].[Na+].
What is the InChIKey of sodium N-aminocarbamate?
The InChIKey is CGHQUHYDOFAJFI-UHFFFAOYSA-M. The full InChI is InChI=1S/CH4N2O2.Na/c2-3-1(4)5;/h3H,2H2,(H,4,5);/q;+1/p-1.
What are the key properties of sodium N-aminocarbamate?
sodium N-aminocarbamate has a molecular weight of 98.04 g/mol, XLogP of -5.20, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium N-aminocarbamate is sourced from PubChem (CID 23710633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).