About 1-amino-3-methylurea;2-aminopropane-1-thiol
1-amino-3-methylurea;2-aminopropane-1-thiol (PubChem CID 158222672) has the molecular formula C5H16N4OS
and a molecular weight of 180.28 g/mol. Its IUPAC name is 1-amino-3-methylurea;2-aminopropane-1-thiol.
Molecular Properties
| Compound Name | 1-amino-3-methylurea;2-aminopropane-1-thiol |
| PubChem CID | 158222672 |
| Molecular Formula | C5H16N4OS |
| Molecular Weight | 180.28 g/mol |
| Exact Mass | 180.10 |
| IUPAC Name | 1-amino-3-methylurea;2-aminopropane-1-thiol |
| SMILES | CC(N)CS.CNC(=O)NN |
| InChI | InChI=1S/C3H9NS.C2H7N3O/c1-3(4)2-5;1-4-2(6)5-3/h3,5H,2,4H2,1H3;3H2,1H3,(H2,4,5,6) |
| InChIKey | GDKVWGLBKPIQLI-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 93.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.28 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1-amino-3-methylurea;2-aminopropane-1-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-3-methylurea;2-aminopropane-1-thiol?
The IUPAC name of 1-amino-3-methylurea;2-aminopropane-1-thiol (CID 158222672) is 1-amino-3-methylurea;2-aminopropane-1-thiol.
What is the SMILES notation for 1-amino-3-methylurea;2-aminopropane-1-thiol?
The canonical SMILES for 1-amino-3-methylurea;2-aminopropane-1-thiol is CC(N)CS.CNC(=O)NN.
What is the InChIKey of 1-amino-3-methylurea;2-aminopropane-1-thiol?
The InChIKey is GDKVWGLBKPIQLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9NS.C2H7N3O/c1-3(4)2-5;1-4-2(6)5-3/h3,5H,2,4H2,1H3;3H2,1H3,(H2,4,5,6).
What are the key properties of 1-amino-3-methylurea;2-aminopropane-1-thiol?
1-amino-3-methylurea;2-aminopropane-1-thiol has a molecular weight of 180.28 g/mol, XLogP of -0.95, 1 rotatable bonds, 5 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-3-methylurea;2-aminopropane-1-thiol is sourced from PubChem (CID 158222672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).