About carbon dioxide;pent-4-enoate;bis(prop-2-en-1-amine);prop-2-enylazanium
carbon dioxide;pent-4-enoate;bis(prop-2-en-1-amine);prop-2-enylazanium (PubChem CID 158230878) has the molecular formula C15H29N3O4
and a molecular weight of 315.41 g/mol. Its IUPAC name is carbon dioxide;pent-4-enoate;bis(prop-2-en-1-amine);prop-2-enylazanium.
Molecular Properties
| Compound Name | carbon dioxide;pent-4-enoate;bis(prop-2-en-1-amine);prop-2-enylazanium |
| PubChem CID | 158230878 |
| Molecular Formula | C15H29N3O4 |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.22 |
| IUPAC Name | carbon dioxide;pent-4-enoate;bis(prop-2-en-1-amine);prop-2-enylazanium |
| SMILES | C=CCCC(=O)[O-].C=CCN.C=CCN.C=CC[NH3+].O=C=O |
| InChI | InChI=1S/C5H8O2.3C3H7N.CO2/c1-2-3-4-5(6)7;3*1-2-3-4;2-1-3/h2H,1,3-4H2,(H,6,7);3*2H,1,3-4H2; |
| InChIKey | GEJGIJKRADEMJG-UHFFFAOYSA-N |
| XLogP | -1.20 |
| TPSA | 153.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze carbon dioxide;pent-4-enoate;bis(prop-2-en-1-amine);prop-2-enylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbon dioxide;pent-4-enoate;bis(prop-2-en-1-amine);prop-2-enylazanium?
The IUPAC name of carbon dioxide;pent-4-enoate;bis(prop-2-en-1-amine);prop-2-enylazanium (CID 158230878) is carbon dioxide;pent-4-enoate;bis(prop-2-en-1-amine);prop-2-enylazanium.
What is the SMILES notation for carbon dioxide;pent-4-enoate;bis(prop-2-en-1-amine);prop-2-enylazanium?
The canonical SMILES for carbon dioxide;pent-4-enoate;bis(prop-2-en-1-amine);prop-2-enylazanium is C=CCCC(=O)[O-].C=CCN.C=CCN.C=CC[NH3+].O=C=O.
What is the InChIKey of carbon dioxide;pent-4-enoate;bis(prop-2-en-1-amine);prop-2-enylazanium?
The InChIKey is GEJGIJKRADEMJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O2.3C3H7N.CO2/c1-2-3-4-5(6)7;3*1-2-3-4;2-1-3/h2H,1,3-4H2,(H,6,7);3*2H,1,3-4H2;.
What are the key properties of carbon dioxide;pent-4-enoate;bis(prop-2-en-1-amine);prop-2-enylazanium?
carbon dioxide;pent-4-enoate;bis(prop-2-en-1-amine);prop-2-enylazanium has a molecular weight of 315.41 g/mol, XLogP of -1.20, 6 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for carbon dioxide;pent-4-enoate;bis(prop-2-en-1-amine);prop-2-enylazanium is sourced from PubChem (CID 158230878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).