About hydroxy-methoxy-oxophosphanium;propanamide
hydroxy-methoxy-oxophosphanium;propanamide (PubChem CID 158251379) has the molecular formula C4H11NO4P+
and a molecular weight of 168.11 g/mol. Its IUPAC name is hydroxy-methoxy-oxophosphanium;propanamide.
Molecular Properties
| Compound Name | hydroxy-methoxy-oxophosphanium;propanamide |
| PubChem CID | 158251379 |
| Molecular Formula | C4H11NO4P+ |
| Molecular Weight | 168.11 g/mol |
| Exact Mass | 168.04 |
| IUPAC Name | hydroxy-methoxy-oxophosphanium;propanamide |
| SMILES | CCC(N)=O.CO[P+](=O)O |
| InChI | InChI=1S/C3H7NO.CH3O3P/c1-2-3(4)5;1-4-5(2)3/h2H2,1H3,(H2,4,5);1H3/p+1 |
| InChIKey | SUKKCGSGVNUMQJ-UHFFFAOYSA-O |
| XLogP | 0.16 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.11 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze hydroxy-methoxy-oxophosphanium;propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydroxy-methoxy-oxophosphanium;propanamide?
The IUPAC name of hydroxy-methoxy-oxophosphanium;propanamide (CID 158251379) is hydroxy-methoxy-oxophosphanium;propanamide.
What is the SMILES notation for hydroxy-methoxy-oxophosphanium;propanamide?
The canonical SMILES for hydroxy-methoxy-oxophosphanium;propanamide is CCC(N)=O.CO[P+](=O)O.
What is the InChIKey of hydroxy-methoxy-oxophosphanium;propanamide?
The InChIKey is SUKKCGSGVNUMQJ-UHFFFAOYSA-O. The full InChI is InChI=1S/C3H7NO.CH3O3P/c1-2-3(4)5;1-4-5(2)3/h2H2,1H3,(H2,4,5);1H3/p+1.
What are the key properties of hydroxy-methoxy-oxophosphanium;propanamide?
hydroxy-methoxy-oxophosphanium;propanamide has a molecular weight of 168.11 g/mol, XLogP of 0.16, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for hydroxy-methoxy-oxophosphanium;propanamide is sourced from PubChem (CID 158251379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).