C73H87B2O6P3 — CID 158305380
CID 158305380 (PubChem CID 158305380) has the molecular formula C73H87B2O6P3 and a molecular weight of 1177.05 g/mol.
| Compound Name | CID 158305380 |
|---|---|
| PubChem CID | 158305380 |
| Molecular Formula | C73H87B2O6P3 |
| Molecular Weight | 1177.05 g/mol |
| Exact Mass | 1176.60 |
| IUPAC Name | — |
| SMILES | CCCC(c1cc(C(C)(C)C)c(O)cc1C)c1cc(C(C)(C)C)c(OP2Oc3ccccc3-c3ccccc32)cc1C.Cc1cc(Cc2cc(C)cc(C(C)(C)C)c2OP2Oc3ccccc3-c3ccccc32)c(O)c(C(C)(C)C)c1.[3H]B([B])P |
| InChI | InChI=1S/C38H45O3P.C35H39O3P.B2H3P/c1-10-15-26(29-22-31(37(4,5)6)33(39)20-24(29)2)30-23-32(38(7,8)9)35(21-25(30)3)41-42-36-19-14-12-17-28(36)27-16-11-13-18-34(27)40-42;1-22-17-24(32(36)28(19-22)34(3,4)5)21-25-18-23(2)20-29(35(6,7)8)33(25)38-39-31-16-12-10-14-27(31)26-13-9-11-15-30(26)37-39;1-2-3/h11-14,16-23,26,39H,10,15H2,1-9H3;9-20,36H,21H2,1-8H3;2H,3H2/i;;2T |
| InChIKey | GFXZXTAURTXJIF-IRKISQMASA-N |
| XLogP | 19.18 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 84 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1177.05 |
| LogP ≤ 5 | 19.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|