C22H29B5O2S — CID 158550582
CID 158550582 (PubChem CID 158550582) has the molecular formula C22H29B5O2S and a molecular weight of 411.60 g/mol.
| Compound Name | CID 158550582 |
|---|---|
| PubChem CID | 158550582 |
| Molecular Formula | C22H29B5O2S |
| Molecular Weight | 411.60 g/mol |
| Exact Mass | 412.24 |
| IUPAC Name | — |
| SMILES | CC1(C)OB(c2ccc3c(c2)C2CC4CC5CC3CC54C2)OC1(C)C.[B]B([B])B=S |
| InChI | InChI=1S/C22H29BO2.B4S/c1-20(2)21(3,4)25-23(24-20)17-5-6-18-13-7-15-9-16-8-14(19(18)10-17)12-22(15,16)11-13;1-4(2)3-5/h5-6,10,13-16H,7-9,11-12H2,1-4H3; |
| InChIKey | GRSFJMOLZQLENF-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.60 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|