C12H10Cl2O2 — CID 158620100
2-[1-(2,4-dichlorobenzoyl)cyclopropyl]acetaldehyde (PubChem CID 158620100) has the molecular formula C12H10Cl2O2 and a molecular weight of 257.12 g/mol. Its IUPAC name is 2-[1-(2,4-dichlorobenzoyl)cyclopropyl]acetaldehyde.
| Compound Name | 2-[1-(2,4-dichlorobenzoyl)cyclopropyl]acetaldehyde |
|---|---|
| PubChem CID | 158620100 |
| Molecular Formula | C12H10Cl2O2 |
| Molecular Weight | 257.12 g/mol |
| Exact Mass | 256.01 |
| IUPAC Name | 2-[1-(2,4-dichlorobenzoyl)cyclopropyl]acetaldehyde |
| SMILES | O=CCC1(C(=O)c2ccc(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C12H10Cl2O2/c13-8-1-2-9(10(14)7-8)11(16)12(3-4-12)5-6-15/h1-2,6-7H,3-5H2 |
| InChIKey | FLLSRLYUEBTRDD-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.12 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|