About benzene;1H-quinoline-2-thione
benzene;1H-quinoline-2-thione (PubChem CID 158676150) has the molecular formula C15H13NS
and a molecular weight of 239.34 g/mol. Its IUPAC name is benzene;1H-quinoline-2-thione.
Molecular Properties
| Compound Name | benzene;1H-quinoline-2-thione |
| PubChem CID | 158676150 |
| Molecular Formula | C15H13NS |
| Molecular Weight | 239.34 g/mol |
| Exact Mass | 239.08 |
| IUPAC Name | benzene;1H-quinoline-2-thione |
| SMILES | S=c1ccc2ccccc2[nH]1.c1ccccc1 |
| InChI | InChI=1S/C9H7NS.C6H6/c11-9-6-5-7-3-1-2-4-8(7)10-9;1-2-4-6-5-3-1/h1-6H,(H,10,11);1-6H |
| InChIKey | IENWPERMZGLXOK-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.34 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze benzene;1H-quinoline-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;1H-quinoline-2-thione?
The IUPAC name of benzene;1H-quinoline-2-thione (CID 158676150) is benzene;1H-quinoline-2-thione.
What is the SMILES notation for benzene;1H-quinoline-2-thione?
The canonical SMILES for benzene;1H-quinoline-2-thione is S=c1ccc2ccccc2[nH]1.c1ccccc1.
What is the InChIKey of benzene;1H-quinoline-2-thione?
The InChIKey is IENWPERMZGLXOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NS.C6H6/c11-9-6-5-7-3-1-2-4-8(7)10-9;1-2-4-6-5-3-1/h1-6H,(H,10,11);1-6H.
What are the key properties of benzene;1H-quinoline-2-thione?
benzene;1H-quinoline-2-thione has a molecular weight of 239.34 g/mol, XLogP of 4.58, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;1H-quinoline-2-thione is sourced from PubChem (CID 158676150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).