About formaldehyde;bis(1H-quinoline-2-thione)
formaldehyde;bis(1H-quinoline-2-thione) (PubChem CID 174248686) has the molecular formula C19H16N2OS2
and a molecular weight of 352.48 g/mol. Its IUPAC name is formaldehyde;bis(1H-quinoline-2-thione).
Molecular Properties
| Compound Name | formaldehyde;bis(1H-quinoline-2-thione) |
| PubChem CID | 174248686 |
| Molecular Formula | C19H16N2OS2 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.07 |
| IUPAC Name | formaldehyde;bis(1H-quinoline-2-thione) |
| SMILES | C=O.S=c1ccc2ccccc2[nH]1.S=c1ccc2ccccc2[nH]1 |
| InChI | InChI=1S/2C9H7NS.CH2O/c2*11-9-6-5-7-3-1-2-4-8(7)10-9;1-2/h2*1-6H,(H,10,11);1H2 |
| InChIKey | WXVRQLNFSIEHJL-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 48.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze formaldehyde;bis(1H-quinoline-2-thione) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formaldehyde;bis(1H-quinoline-2-thione)?
The IUPAC name of formaldehyde;bis(1H-quinoline-2-thione) (CID 174248686) is formaldehyde;bis(1H-quinoline-2-thione).
What is the SMILES notation for formaldehyde;bis(1H-quinoline-2-thione)?
The canonical SMILES for formaldehyde;bis(1H-quinoline-2-thione) is C=O.S=c1ccc2ccccc2[nH]1.S=c1ccc2ccccc2[nH]1.
What is the InChIKey of formaldehyde;bis(1H-quinoline-2-thione)?
The InChIKey is WXVRQLNFSIEHJL-UHFFFAOYSA-N. The full InChI is InChI=1S/2C9H7NS.CH2O/c2*11-9-6-5-7-3-1-2-4-8(7)10-9;1-2/h2*1-6H,(H,10,11);1H2.
What are the key properties of formaldehyde;bis(1H-quinoline-2-thione)?
formaldehyde;bis(1H-quinoline-2-thione) has a molecular weight of 352.48 g/mol, XLogP of 5.61, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for formaldehyde;bis(1H-quinoline-2-thione) is sourced from PubChem (CID 174248686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).