C17H27N10O2+ — CID 158691893
2-amino-7-methyl-9-propan-2-yl-4,5-dihydro-1H-purin-7-ium-6-one;2-amino-9-propan-2-yl-1H-purin-6-one (PubChem CID 158691893) has the molecular formula C17H27N10O2+ and a molecular weight of 403.47 g/mol. Its IUPAC name is 2-amino-7-methyl-9-propan-2-yl-4,5-dihydro-1H-purin-7-ium-6-one;2-amino-9-propan-2-yl-1H-purin-6-one.
| Compound Name | 2-amino-7-methyl-9-propan-2-yl-4,5-dihydro-1H-purin-7-ium-6-one;2-amino-9-propan-2-yl-1H-purin-6-one |
|---|---|
| PubChem CID | 158691893 |
| Molecular Formula | C17H27N10O2+ |
| Molecular Weight | 403.47 g/mol |
| Exact Mass | 403.23 |
| IUPAC Name | 2-amino-7-methyl-9-propan-2-yl-4,5-dihydro-1H-purin-7-ium-6-one;2-amino-9-propan-2-yl-1H-purin-6-one |
| SMILES | CC(C)N1C=[N+](C)C2C(=O)NC(N)=NC21.CC(C)n1cnc2c(=O)[nH]c(N)nc21 |
| InChI | InChI=1S/C9H15N5O.C8H11N5O/c1-5(2)14-4-13(3)6-7(14)11-9(10)12-8(6)15;1-4(2)13-3-10-5-6(13)11-8(9)12-7(5)14/h4-7H,1-3H3,(H2-,10,11,12,15);3-4H,1-2H3,(H3,9,11,12,14)/p+1 |
| InChIKey | IGLLKAVZOWCJQC-UHFFFAOYSA-O |
| XLogP | -1.20 |
| TPSA | 163.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.47 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|