C48H50F10O10S2 — CID 158852981
tert-butyl 4-[4-[4-(3,3,4,4,4-pentafluorobutyl)phenyl]phenyl]sulfonyloxane-4-carboxylate;4-[4-[4-(3,3,4,4,4-pentafluorobutyl)phenyl]phenyl]sulfonyloxane-4-carboxylic acid (PubChem CID 158852981) has the molecular formula C48H50F10O10S2 and a molecular weight of 1041.03 g/mol. Its IUPAC name is tert-butyl 4-[4-[4-(3,3,4,4,4-pentafluorobutyl)phenyl]phenyl]sulfonyloxane-4-carboxylate;4-[4-[4-(3,3,4,4,4-pentafluorobutyl)phenyl]phenyl]sulfonyloxane-4-carboxylic acid.
| Compound Name | tert-butyl 4-[4-[4-(3,3,4,4,4-pentafluorobutyl)phenyl]phenyl]sulfonyloxane-4-carboxylate;4-[4-[4-(3,3,4,4,4-pentafluorobutyl)phenyl]phenyl]sulfonyloxane-4-carboxylic acid |
|---|---|
| PubChem CID | 158852981 |
| Molecular Formula | C48H50F10O10S2 |
| Molecular Weight | 1041.03 g/mol |
| Exact Mass | 1040.27 |
| IUPAC Name | tert-butyl 4-[4-[4-(3,3,4,4,4-pentafluorobutyl)phenyl]phenyl]sulfonyloxane-4-carboxylate;4-[4-[4-(3,3,4,4,4-pentafluorobutyl)phenyl]phenyl]sulfonyloxane-4-carboxylic acid |
| SMILES | CC(C)(C)OC(=O)C1(S(=O)(=O)c2ccc(-c3ccc(CCC(F)(F)C(F)(F)F)cc3)cc2)CCOCC1.O=C(O)C1(S(=O)(=O)c2ccc(-c3ccc(CCC(F)(F)C(F)(F)F)cc3)cc2)CCOCC1 |
| InChI | InChI=1S/C26H29F5O5S.C22H21F5O5S/c1-23(2,3)36-22(32)24(14-16-35-17-15-24)37(33,34)21-10-8-20(9-11-21)19-6-4-18(5-7-19)12-13-25(27,28)26(29,30)31;23-21(24,22(25,26)27)10-9-15-1-3-16(4-2-15)17-5-7-18(8-6-17)33(30,31)20(19(28)29)11-13-32-14-12-20/h4-11H,12-17H2,1-3H3;1-8H,9-14H2,(H,28,29) |
| InChIKey | IZRQHRDPNNSGMZ-UHFFFAOYSA-N |
| XLogP | 11.04 |
| TPSA | 150.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1041.03 |
| LogP ≤ 5 | 11.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|