C24H39N2O13P3S2 — CID 158893939
[hydroxy-[[3-hydroxy-5-[4-[3-[3-(pyridin-2-yldisulfanyl)propanoylamino]prop-1-ynyl]cyclooctyl]oxolan-2-yl]methoxy]phosphoryl] phosphono hydrogen phosphate;molecular hydrogen (PubChem CID 158893939) has the molecular formula C24H39N2O13P3S2 and a molecular weight of 720.63 g/mol. Its IUPAC name is [hydroxy-[[3-hydroxy-5-[4-[3-[3-(pyridin-2-yldisulfanyl)propanoylamino]prop-1-ynyl]cyclooctyl]oxolan-2-yl]methoxy]phosphoryl] phosphono hydrogen phosphate;molecular hydrogen.
| Compound Name | [hydroxy-[[3-hydroxy-5-[4-[3-[3-(pyridin-2-yldisulfanyl)propanoylamino]prop-1-ynyl]cyclooctyl]oxolan-2-yl]methoxy]phosphoryl] phosphono hydrogen phosphate;molecular hydrogen |
|---|---|
| PubChem CID | 158893939 |
| Molecular Formula | C24H39N2O13P3S2 |
| Molecular Weight | 720.63 g/mol |
| Exact Mass | 720.11 |
| IUPAC Name | [hydroxy-[[3-hydroxy-5-[4-[3-[3-(pyridin-2-yldisulfanyl)propanoylamino]prop-1-ynyl]cyclooctyl]oxolan-2-yl]methoxy]phosphoryl] phosphono hydrogen phosphate;molecular hydrogen |
| SMILES | O=C(CCSSc1ccccn1)NCC#CC1CCCCC(C2CC(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O2)CC1.[H][H] |
| InChI | InChI=1S/C24H37N2O13P3S2.H2/c27-20-16-21(37-22(20)17-36-41(32,33)39-42(34,35)38-40(29,30)31)19-8-2-1-6-18(10-11-19)7-5-14-25-23(28)12-15-43-44-24-9-3-4-13-26-24;/h3-4,9,13,18-22,27H,1-2,6,8,10-12,14-17H2,(H,25,28)(H,32,33)(H,34,35)(H2,29,30,31);1H |
| InChIKey | JEPCATSIGCISSP-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 231.27 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.63 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|