C21H22ClNO4 — CID 15896108
3,4,10,11-tetramethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium chloride (PubChem CID 15896108) has the molecular formula C21H22ClNO4 and a molecular weight of 387.86 g/mol. Its IUPAC name is 3,4,10,11-tetramethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium chloride.
| Compound Name | 3,4,10,11-tetramethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium chloride |
|---|---|
| PubChem CID | 15896108 |
| Molecular Formula | C21H22ClNO4 |
| Molecular Weight | 387.86 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | 3,4,10,11-tetramethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium chloride |
| SMILES | COc1cc2cc3[n+](cc2cc1OC)CCc1c-3ccc(OC)c1OC.[Cl-] |
| InChI | InChI=1S/C21H22NO4.ClH/c1-23-18-6-5-15-16(21(18)26-4)7-8-22-12-14-11-20(25-3)19(24-2)10-13(14)9-17(15)22;/h5-6,9-12H,7-8H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | KGAMIQFYWUFIHH-UHFFFAOYSA-M |
| XLogP | 0.39 |
| TPSA | 40.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.86 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|